About cis-methyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]-1-pentanoylcyclopentane-1-carboxylate
cis-methyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]-1-pentanoylcyclopentane-1-carboxylate (PubChem CID 74765979) has the molecular formula C18H30O4
and a molecular weight of 310.43 g/mol. Its IUPAC name is cis-methyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]-1-pentanoylcyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | cis-methyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]-1-pentanoylcyclopentane-1-carboxylate |
| PubChem CID | 74765979 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | cis-methyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]-1-pentanoylcyclopentane-1-carboxylate |
| SMILES | C=C[C@H]1CC(C(=O)CCCC)(C(=O)OC)C[C@@H]1OC(C)(C)C |
| InChI | InChI=1S/C18H30O4/c1-7-9-10-15(19)18(16(20)21-6)11-13(8-2)14(12-18)22-17(3,4)5/h8,13-14H,2,7,9-12H2,1,3-6H3/t13-,14-,18?/m0/s1 |
| InChIKey | PDXQLGUQUXEIAY-QPKCZYJBSA-N |
| XLogP | 3.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cis-methyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]-1-pentanoylcyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]-1-pentanoylcyclopentane-1-carboxylate?
The IUPAC name of cis-methyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]-1-pentanoylcyclopentane-1-carboxylate (CID 74765979) is cis-methyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]-1-pentanoylcyclopentane-1-carboxylate.
What is the SMILES notation for cis-methyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]-1-pentanoylcyclopentane-1-carboxylate?
The canonical SMILES for cis-methyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]-1-pentanoylcyclopentane-1-carboxylate is C=C[C@H]1CC(C(=O)CCCC)(C(=O)OC)C[C@@H]1OC(C)(C)C.
What is the InChIKey of cis-methyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]-1-pentanoylcyclopentane-1-carboxylate?
The InChIKey is PDXQLGUQUXEIAY-QPKCZYJBSA-N. The full InChI is InChI=1S/C18H30O4/c1-7-9-10-15(19)18(16(20)21-6)11-13(8-2)14(12-18)22-17(3,4)5/h8,13-14H,2,7,9-12H2,1,3-6H3/t13-,14-,18?/m0/s1.
What are the key properties of cis-methyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]-1-pentanoylcyclopentane-1-carboxylate?
cis-methyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]-1-pentanoylcyclopentane-1-carboxylate has a molecular weight of 310.43 g/mol, XLogP of 3.68, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (3R,4S)-3-ethenyl-4-[(2-methylpropan-2-yl)oxy]-1-pentanoylcyclopentane-1-carboxylate is sourced from PubChem (CID 74765979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).