C19H13ClF2N2O3 — CID 74766068
ethyl (Z)-3-(4-chlorophenyl)-2-cyano-3-[(2,6-difluorobenzoyl)amino]prop-2-enoate (PubChem CID 74766068) has the molecular formula C19H13ClF2N2O3 and a molecular weight of 390.77 g/mol. Its IUPAC name is ethyl (Z)-3-(4-chlorophenyl)-2-cyano-3-[(2,6-difluorobenzoyl)amino]prop-2-enoate.
| Compound Name | ethyl (Z)-3-(4-chlorophenyl)-2-cyano-3-[(2,6-difluorobenzoyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 74766068 |
| Molecular Formula | C19H13ClF2N2O3 |
| Molecular Weight | 390.77 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | ethyl (Z)-3-(4-chlorophenyl)-2-cyano-3-[(2,6-difluorobenzoyl)amino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C(\NC(=O)c1c(F)cccc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H13ClF2N2O3/c1-2-27-19(26)13(10-23)17(11-6-8-12(20)9-7-11)24-18(25)16-14(21)4-3-5-15(16)22/h3-9H,2H2,1H3,(H,24,25)/b17-13- |
| InChIKey | QZHMMDWDQNIESH-LGMDPLHJSA-N |
| XLogP | 3.85 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.77 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|