C20H20N2O5 — CID 7476717
[(2R)-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl] 3-nitrobenzoate (PubChem CID 7476717) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl] 3-nitrobenzoate.
| Compound Name | [(2R)-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 7476717 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [(2R)-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl] 3-nitrobenzoate |
| SMILES | C[C@@H](OC(=O)c1cccc([N+](=O)[O-])c1)C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C20H20N2O5/c1-13(27-20(24)15-8-4-9-16(12-15)22(25)26)19(23)21-18-11-5-7-14-6-2-3-10-17(14)18/h2-4,6,8-10,12-13,18H,5,7,11H2,1H3,(H,21,23)/t13-,18-/m1/s1 |
| InChIKey | NHFJKAQWVWGZTA-FZKQIMNGSA-N |
| XLogP | 3.33 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|