C26H31Cl2N5O3 — CID 74767282
1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[(1-methylazetidin-3-yl)methoxy]-1-phenylpyrazol-5-yl]urea (PubChem CID 74767282) has the molecular formula C26H31Cl2N5O3 and a molecular weight of 532.47 g/mol. Its IUPAC name is 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[(1-methylazetidin-3-yl)methoxy]-1-phenylpyrazol-5-yl]urea.
| Compound Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[(1-methylazetidin-3-yl)methoxy]-1-phenylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 74767282 |
| Molecular Formula | C26H31Cl2N5O3 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[(1-methylazetidin-3-yl)methoxy]-1-phenylpyrazol-5-yl]urea |
| SMILES | COCCCc1cc(Cl)c(Cl)cc1NC(=O)Nc1c(C)c(OCC2CN(C)C2)nn1-c1ccccc1 |
| InChI | InChI=1S/C26H31Cl2N5O3/c1-17-24(30-26(34)29-23-13-22(28)21(27)12-19(23)8-7-11-35-3)33(20-9-5-4-6-10-20)31-25(17)36-16-18-14-32(2)15-18/h4-6,9-10,12-13,18H,7-8,11,14-16H2,1-3H3,(H2,29,30,34) |
| InChIKey | FXLSHQRRPCCHBD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|