C28H35Cl2N5O3 — CID 74767284
1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[[(3S)-1-methylpiperidin-3-yl]methoxy]-1-phenylpyrazol-5-yl]urea (PubChem CID 74767284) has the molecular formula C28H35Cl2N5O3 and a molecular weight of 560.53 g/mol. Its IUPAC name is 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[[(3S)-1-methylpiperidin-3-yl]methoxy]-1-phenylpyrazol-5-yl]urea.
| Compound Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[[(3S)-1-methylpiperidin-3-yl]methoxy]-1-phenylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 74767284 |
| Molecular Formula | C28H35Cl2N5O3 |
| Molecular Weight | 560.53 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[[(3S)-1-methylpiperidin-3-yl]methoxy]-1-phenylpyrazol-5-yl]urea |
| SMILES | COCCCc1cc(Cl)c(Cl)cc1NC(=O)Nc1c(C)c(OC[C@H]2CCCN(C)C2)nn1-c1ccccc1 |
| InChI | InChI=1S/C28H35Cl2N5O3/c1-19-26(32-28(36)31-25-16-24(30)23(29)15-21(25)10-8-14-37-3)35(22-11-5-4-6-12-22)33-27(19)38-18-20-9-7-13-34(2)17-20/h4-6,11-12,15-16,20H,7-10,13-14,17-18H2,1-3H3,(H2,31,32,36)/t20-/m0/s1 |
| InChIKey | HBUIYMJZOZMUNX-FQEVSTJZSA-N |
| XLogP | 6.43 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.53 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|