C27H33Cl2N5O4 — CID 74767359
1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[[(2S)-4-methylmorpholin-2-yl]methoxy]-1-phenylpyrazol-5-yl]urea (PubChem CID 74767359) has the molecular formula C27H33Cl2N5O4 and a molecular weight of 562.50 g/mol. Its IUPAC name is 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[[(2S)-4-methylmorpholin-2-yl]methoxy]-1-phenylpyrazol-5-yl]urea.
| Compound Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[[(2S)-4-methylmorpholin-2-yl]methoxy]-1-phenylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 74767359 |
| Molecular Formula | C27H33Cl2N5O4 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-3-[[(2S)-4-methylmorpholin-2-yl]methoxy]-1-phenylpyrazol-5-yl]urea |
| SMILES | COCCCc1cc(Cl)c(Cl)cc1NC(=O)Nc1c(C)c(OC[C@@H]2CN(C)CCO2)nn1-c1ccccc1 |
| InChI | InChI=1S/C27H33Cl2N5O4/c1-18-25(31-27(35)30-24-15-23(29)22(28)14-19(24)8-7-12-36-3)34(20-9-5-4-6-10-20)32-26(18)38-17-21-16-33(2)11-13-37-21/h4-6,9-10,14-15,21H,7-8,11-13,16-17H2,1-3H3,(H2,30,31,35)/t21-/m0/s1 |
| InChIKey | ZTWPVSKQXFLZFI-NRFANRHFSA-N |
| XLogP | 5.42 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|