C28H35Cl2N5O3 — CID 74767443
1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-1-phenyl-3-(2-piperidin-4-ylethoxy)pyrazol-5-yl]urea (PubChem CID 74767443) has the molecular formula C28H35Cl2N5O3 and a molecular weight of 560.53 g/mol. Its IUPAC name is 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-1-phenyl-3-(2-piperidin-4-ylethoxy)pyrazol-5-yl]urea.
| Compound Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-1-phenyl-3-(2-piperidin-4-ylethoxy)pyrazol-5-yl]urea |
|---|---|
| PubChem CID | 74767443 |
| Molecular Formula | C28H35Cl2N5O3 |
| Molecular Weight | 560.53 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | 1-[4,5-dichloro-2-(3-methoxypropyl)phenyl]-3-[4-methyl-1-phenyl-3-(2-piperidin-4-ylethoxy)pyrazol-5-yl]urea |
| SMILES | COCCCc1cc(Cl)c(Cl)cc1NC(=O)Nc1c(C)c(OCCC2CCNCC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C28H35Cl2N5O3/c1-19-26(33-28(36)32-25-18-24(30)23(29)17-21(25)7-6-15-37-2)35(22-8-4-3-5-9-22)34-27(19)38-16-12-20-10-13-31-14-11-20/h3-5,8-9,17-18,20,31H,6-7,10-16H2,1-2H3,(H2,32,33,36) |
| InChIKey | BNBBFIILYIXSRP-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 89.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|