C22H29F3N6 — CID 74767557
N,N-dimethyl-2-[4-(5,6,7,8-tetrahydropyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-2-[4-(trifluoromethyl)phenyl]ethanamine (PubChem CID 74767557) has the molecular formula C22H29F3N6 and a molecular weight of 434.51 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-(5,6,7,8-tetrahydropyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-2-[4-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | N,N-dimethyl-2-[4-(5,6,7,8-tetrahydropyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-2-[4-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 74767557 |
| Molecular Formula | C22H29F3N6 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | N,N-dimethyl-2-[4-(5,6,7,8-tetrahydropyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-2-[4-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CN(C)CC(c1ccc(C(F)(F)F)cc1)N1CCN(c2ncnc3c2CCCN3)CC1 |
| InChI | InChI=1S/C22H29F3N6/c1-29(2)14-19(16-5-7-17(8-6-16)22(23,24)25)30-10-12-31(13-11-30)21-18-4-3-9-26-20(18)27-15-28-21/h5-8,15,19H,3-4,9-14H2,1-2H3,(H,26,27,28) |
| InChIKey | DXIDCSBKUQPZSC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |