C22H28F4N6 — CID 74767712
2-[3-fluoro-4-(trifluoromethyl)phenyl]-N,N-dimethyl-2-[4-(5,6,7,8-tetrahydropyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanamine (PubChem CID 74767712) has the molecular formula C22H28F4N6 and a molecular weight of 452.50 g/mol. Its IUPAC name is 2-[3-fluoro-4-(trifluoromethyl)phenyl]-N,N-dimethyl-2-[4-(5,6,7,8-tetrahydropyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanamine.
| Compound Name | 2-[3-fluoro-4-(trifluoromethyl)phenyl]-N,N-dimethyl-2-[4-(5,6,7,8-tetrahydropyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanamine |
|---|---|
| PubChem CID | 74767712 |
| Molecular Formula | C22H28F4N6 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-[3-fluoro-4-(trifluoromethyl)phenyl]-N,N-dimethyl-2-[4-(5,6,7,8-tetrahydropyrido[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanamine |
| SMILES | CN(C)CC(c1ccc(C(F)(F)F)c(F)c1)N1CCN(c2ncnc3c2CCCN3)CC1 |
| InChI | InChI=1S/C22H28F4N6/c1-30(2)13-19(15-5-6-17(18(23)12-15)22(24,25)26)31-8-10-32(11-9-31)21-16-4-3-7-27-20(16)28-14-29-21/h5-6,12,14,19H,3-4,7-11,13H2,1-2H3,(H,27,28,29) |
| InChIKey | ADGNQMNEVYGZMR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |