About (3-cyanophenyl)methyl 2-bromobenzoate
(3-cyanophenyl)methyl 2-bromobenzoate (PubChem CID 7476786) has the molecular formula C15H10BrNO2
and a molecular weight of 316.15 g/mol. Its IUPAC name is (3-cyanophenyl)methyl 2-bromobenzoate.
Molecular Properties
| Compound Name | (3-cyanophenyl)methyl 2-bromobenzoate |
| PubChem CID | 7476786 |
| Molecular Formula | C15H10BrNO2 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | (3-cyanophenyl)methyl 2-bromobenzoate |
| SMILES | N#Cc1cccc(COC(=O)c2ccccc2Br)c1 |
| InChI | InChI=1S/C15H10BrNO2/c16-14-7-2-1-6-13(14)15(18)19-10-12-5-3-4-11(8-12)9-17/h1-8H,10H2 |
| InChIKey | MTQXHDLDVANEQN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-cyanophenyl)methyl 2-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyanophenyl)methyl 2-bromobenzoate?
The IUPAC name of (3-cyanophenyl)methyl 2-bromobenzoate (CID 7476786) is (3-cyanophenyl)methyl 2-bromobenzoate.
What is the SMILES notation for (3-cyanophenyl)methyl 2-bromobenzoate?
The canonical SMILES for (3-cyanophenyl)methyl 2-bromobenzoate is N#Cc1cccc(COC(=O)c2ccccc2Br)c1.
What is the InChIKey of (3-cyanophenyl)methyl 2-bromobenzoate?
The InChIKey is MTQXHDLDVANEQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrNO2/c16-14-7-2-1-6-13(14)15(18)19-10-12-5-3-4-11(8-12)9-17/h1-8H,10H2.
What are the key properties of (3-cyanophenyl)methyl 2-bromobenzoate?
(3-cyanophenyl)methyl 2-bromobenzoate has a molecular weight of 316.15 g/mol, XLogP of 3.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyanophenyl)methyl 2-bromobenzoate is sourced from PubChem (CID 7476786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).