C17H24O5 — CID 74767940
(2E,6E)-8-(2-ethoxy-4-methyl-5-oxofuran-2-yl)-3,7-dimethylocta-2,6-dienoic acid (PubChem CID 74767940) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is (2E,6E)-8-(2-ethoxy-4-methyl-5-oxofuran-2-yl)-3,7-dimethylocta-2,6-dienoic acid.
| Compound Name | (2E,6E)-8-(2-ethoxy-4-methyl-5-oxofuran-2-yl)-3,7-dimethylocta-2,6-dienoic acid |
|---|---|
| PubChem CID | 74767940 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (2E,6E)-8-(2-ethoxy-4-methyl-5-oxofuran-2-yl)-3,7-dimethylocta-2,6-dienoic acid |
| SMILES | CCOC1(C/C(C)=C/CC/C(C)=C/C(=O)O)C=C(C)C(=O)O1 |
| InChI | InChI=1S/C17H24O5/c1-5-21-17(11-14(4)16(20)22-17)10-13(3)8-6-7-12(2)9-15(18)19/h8-9,11H,5-7,10H2,1-4H3,(H,18,19)/b12-9+,13-8+ |
| InChIKey | YTRVTHPKWXYBOD-GHEQENTPSA-N |
| XLogP | 3.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|