C14H19N3O5 — CID 7477454
(2R,6R)-N-(2-methoxy-4-nitrophenyl)-2,6-dimethylmorpholine-4-carboxamide (PubChem CID 7477454) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is (2R,6R)-N-(2-methoxy-4-nitrophenyl)-2,6-dimethylmorpholine-4-carboxamide.
| Compound Name | (2R,6R)-N-(2-methoxy-4-nitrophenyl)-2,6-dimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 7477454 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (2R,6R)-N-(2-methoxy-4-nitrophenyl)-2,6-dimethylmorpholine-4-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)N1C[C@@H](C)O[C@H](C)C1 |
| InChI | InChI=1S/C14H19N3O5/c1-9-7-16(8-10(2)22-9)14(18)15-12-5-4-11(17(19)20)6-13(12)21-3/h4-6,9-10H,7-8H2,1-3H3,(H,15,18)/t9-,10-/m1/s1 |
| InChIKey | ZABXJRVFUMHSDN-NXEZZACHSA-N |
| XLogP | 2.24 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|