C24H28N2O5 — CID 7477482
propan-2-yl 4-[[(3R)-5-oxo-1-(4-propoxyphenyl)pyrrolidine-3-carbonyl]amino]benzoate (PubChem CID 7477482) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is propan-2-yl 4-[[(3R)-5-oxo-1-(4-propoxyphenyl)pyrrolidine-3-carbonyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[(3R)-5-oxo-1-(4-propoxyphenyl)pyrrolidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 7477482 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | propan-2-yl 4-[[(3R)-5-oxo-1-(4-propoxyphenyl)pyrrolidine-3-carbonyl]amino]benzoate |
| SMILES | CCCOc1ccc(N2C[C@H](C(=O)Nc3ccc(C(=O)OC(C)C)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C24H28N2O5/c1-4-13-30-21-11-9-20(10-12-21)26-15-18(14-22(26)27)23(28)25-19-7-5-17(6-8-19)24(29)31-16(2)3/h5-12,16,18H,4,13-15H2,1-3H3,(H,25,28)/t18-/m1/s1 |
| InChIKey | RCDUOGPBMHHLNK-GOSISDBHSA-N |
| XLogP | 4.03 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |