About ethyl 1-[[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]methyl]-4-(2-methoxyethyl)piperidine-4-carboxylate
ethyl 1-[[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]methyl]-4-(2-methoxyethyl)piperidine-4-carboxylate (PubChem CID 74775207) has the molecular formula C23H37N3O3
and a molecular weight of 403.57 g/mol. Its IUPAC name is ethyl 1-[[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]methyl]-4-(2-methoxyethyl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]methyl]-4-(2-methoxyethyl)piperidine-4-carboxylate |
| PubChem CID | 74775207 |
| Molecular Formula | C23H37N3O3 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | ethyl 1-[[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]methyl]-4-(2-methoxyethyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(CCOC)CCN(CC2CNNC2c2cc(C)ccc2C)CC1 |
| InChI | InChI=1S/C23H37N3O3/c1-5-29-22(27)23(10-13-28-4)8-11-26(12-9-23)16-19-15-24-25-21(19)20-14-17(2)6-7-18(20)3/h6-7,14,19,21,24-25H,5,8-13,15-16H2,1-4H3 |
| InChIKey | NJOADLPRRVGUAZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-[[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]methyl]-4-(2-methoxyethyl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]methyl]-4-(2-methoxyethyl)piperidine-4-carboxylate?
The IUPAC name of ethyl 1-[[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]methyl]-4-(2-methoxyethyl)piperidine-4-carboxylate (CID 74775207) is ethyl 1-[[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]methyl]-4-(2-methoxyethyl)piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-[[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]methyl]-4-(2-methoxyethyl)piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-[[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]methyl]-4-(2-methoxyethyl)piperidine-4-carboxylate is CCOC(=O)C1(CCOC)CCN(CC2CNNC2c2cc(C)ccc2C)CC1.
What is the InChIKey of ethyl 1-[[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]methyl]-4-(2-methoxyethyl)piperidine-4-carboxylate?
The InChIKey is NJOADLPRRVGUAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H37N3O3/c1-5-29-22(27)23(10-13-28-4)8-11-26(12-9-23)16-19-15-24-25-21(19)20-14-17(2)6-7-18(20)3/h6-7,14,19,21,24-25H,5,8-13,15-16H2,1-4H3.
What are the key properties of ethyl 1-[[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]methyl]-4-(2-methoxyethyl)piperidine-4-carboxylate?
ethyl 1-[[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]methyl]-4-(2-methoxyethyl)piperidine-4-carboxylate has a molecular weight of 403.57 g/mol, XLogP of 2.75, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[[3-(2,5-dimethylphenyl)pyrazolidin-4-yl]methyl]-4-(2-methoxyethyl)piperidine-4-carboxylate is sourced from PubChem (CID 74775207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).