C23H23N4O3S+ — CID 74782449
7-benzyl-1,3-dimethyl-N-(2-methylsulfanylphenyl)-2,4-dioxo-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide (PubChem CID 74782449) has the molecular formula C23H23N4O3S+ and a molecular weight of 435.53 g/mol. Its IUPAC name is 7-benzyl-1,3-dimethyl-N-(2-methylsulfanylphenyl)-2,4-dioxo-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide.
| Compound Name | 7-benzyl-1,3-dimethyl-N-(2-methylsulfanylphenyl)-2,4-dioxo-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide |
|---|---|
| PubChem CID | 74782449 |
| Molecular Formula | C23H23N4O3S+ |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 7-benzyl-1,3-dimethyl-N-(2-methylsulfanylphenyl)-2,4-dioxo-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide |
| SMILES | CSc1ccccc1NC(=O)C1=CC2C(=O)N(C)C(=O)N(C)C2=[N+]1Cc1ccccc1 |
| InChI | InChI=1S/C23H22N4O3S/c1-25-21-16(22(29)26(2)23(25)30)13-18(27(21)14-15-9-5-4-6-10-15)20(28)24-17-11-7-8-12-19(17)31-3/h4-13,16H,14H2,1-3H3/p+1 |
| InChIKey | HWYIXVSUOBRZEM-UHFFFAOYSA-O |
| XLogP | 3.00 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|