C24H23N4O4+ — CID 74782480
7-benzyl-1,3-dimethyl-2,4-dioxo-N-phenacyl-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide (PubChem CID 74782480) has the molecular formula C24H23N4O4+ and a molecular weight of 431.47 g/mol. Its IUPAC name is 7-benzyl-1,3-dimethyl-2,4-dioxo-N-phenacyl-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide.
| Compound Name | 7-benzyl-1,3-dimethyl-2,4-dioxo-N-phenacyl-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide |
|---|---|
| PubChem CID | 74782480 |
| Molecular Formula | C24H23N4O4+ |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 7-benzyl-1,3-dimethyl-2,4-dioxo-N-phenacyl-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide |
| SMILES | CN1C(=O)C2C=C(C(=O)NCC(=O)c3ccccc3)[N+](Cc3ccccc3)=C2N(C)C1=O |
| InChI | InChI=1S/C24H22N4O4/c1-26-22-18(23(31)27(2)24(26)32)13-19(28(22)15-16-9-5-3-6-10-16)21(30)25-14-20(29)17-11-7-4-8-12-17/h3-13,18H,14-15H2,1-2H3/p+1 |
| InChIKey | DMPDVDLTHNSUIB-UHFFFAOYSA-O |
| XLogP | 1.63 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|