C20H21N4O4S+ — CID 74782483
7-benzyl-1,3-dimethyl-2,4-dioxo-N-(2-oxothiolan-3-yl)-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide (PubChem CID 74782483) has the molecular formula C20H21N4O4S+ and a molecular weight of 413.48 g/mol. Its IUPAC name is 7-benzyl-1,3-dimethyl-2,4-dioxo-N-(2-oxothiolan-3-yl)-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide.
| Compound Name | 7-benzyl-1,3-dimethyl-2,4-dioxo-N-(2-oxothiolan-3-yl)-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide |
|---|---|
| PubChem CID | 74782483 |
| Molecular Formula | C20H21N4O4S+ |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 7-benzyl-1,3-dimethyl-2,4-dioxo-N-(2-oxothiolan-3-yl)-4aH-pyrrolo[2,3-d]pyrimidin-7-ium-6-carboxamide |
| SMILES | CN1C(=O)C2C=C(C(=O)NC3CCSC3=O)[N+](Cc3ccccc3)=C2N(C)C1=O |
| InChI | InChI=1S/C20H20N4O4S/c1-22-17-13(18(26)23(2)20(22)28)10-15(16(25)21-14-8-9-29-19(14)27)24(17)11-12-6-4-3-5-7-12/h3-7,10,13-14H,8-9,11H2,1-2H3/p+1 |
| InChIKey | HKYITEQCLZPBPT-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|