About [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 4-fluorobenzoate
[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 4-fluorobenzoate (PubChem CID 7478278) has the molecular formula C16H16FNO3
and a molecular weight of 289.31 g/mol. Its IUPAC name is [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 4-fluorobenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 4-fluorobenzoate |
| PubChem CID | 7478278 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 4-fluorobenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc(F)cc2)c(C)n1C |
| InChI | InChI=1S/C16H16FNO3/c1-10-8-14(11(2)18(10)3)15(19)9-21-16(20)12-4-6-13(17)7-5-12/h4-8H,9H2,1-3H3 |
| InChIKey | PBHYERGXWLENCJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 4-fluorobenzoate?
The IUPAC name of [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 4-fluorobenzoate (CID 7478278) is [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 4-fluorobenzoate.
What is the SMILES notation for [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 4-fluorobenzoate?
The canonical SMILES for [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 4-fluorobenzoate is Cc1cc(C(=O)COC(=O)c2ccc(F)cc2)c(C)n1C.
What is the InChIKey of [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 4-fluorobenzoate?
The InChIKey is PBHYERGXWLENCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FNO3/c1-10-8-14(11(2)18(10)3)15(19)9-21-16(20)12-4-6-13(17)7-5-12/h4-8H,9H2,1-3H3.
What are the key properties of [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 4-fluorobenzoate?
[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 4-fluorobenzoate has a molecular weight of 289.31 g/mol, XLogP of 2.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethyl] 4-fluorobenzoate is sourced from PubChem (CID 7478278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).