About (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-fluorobenzoate
(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-fluorobenzoate (PubChem CID 7478323) has the molecular formula C15H11FN2O3S
and a molecular weight of 318.33 g/mol. Its IUPAC name is (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-fluorobenzoate.
Molecular Properties
| Compound Name | (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-fluorobenzoate |
| PubChem CID | 7478323 |
| Molecular Formula | C15H11FN2O3S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-fluorobenzoate |
| SMILES | Cc1csc2nc(COC(=O)c3ccc(F)cc3)cc(=O)n12 |
| InChI | InChI=1S/C15H11FN2O3S/c1-9-8-22-15-17-12(6-13(19)18(9)15)7-21-14(20)10-2-4-11(16)5-3-10/h2-6,8H,7H2,1H3 |
| InChIKey | VKNBJMOJQFCALT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-fluorobenzoate?
The IUPAC name of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-fluorobenzoate (CID 7478323) is (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-fluorobenzoate.
What is the SMILES notation for (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-fluorobenzoate?
The canonical SMILES for (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-fluorobenzoate is Cc1csc2nc(COC(=O)c3ccc(F)cc3)cc(=O)n12.
What is the InChIKey of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-fluorobenzoate?
The InChIKey is VKNBJMOJQFCALT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11FN2O3S/c1-9-8-22-15-17-12(6-13(19)18(9)15)7-21-14(20)10-2-4-11(16)5-3-10/h2-6,8H,7H2,1H3.
What are the key properties of (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-fluorobenzoate?
(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-fluorobenzoate has a molecular weight of 318.33 g/mol, XLogP of 2.56, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 4-fluorobenzoate is sourced from PubChem (CID 7478323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).