C21H17NO4 — CID 747841
(15R,19R)-17-ethyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid (PubChem CID 747841) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is (15R,19R)-17-ethyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid.
| Compound Name | (15R,19R)-17-ethyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid |
|---|---|
| PubChem CID | 747841 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (15R,19R)-17-ethyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-1-carboxylic acid |
| SMILES | CCN1C(=O)[C@@H]2C3c4ccccc4C(C(=O)O)(c4ccccc43)[C@@H]2C1=O |
| InChI | InChI=1S/C21H17NO4/c1-2-22-18(23)16-15-11-7-3-5-9-13(11)21(20(25)26,17(16)19(22)24)14-10-6-4-8-12(14)15/h3-10,15-17H,2H2,1H3,(H,25,26)/t15?,16-,17+,21?/m1/s1 |
| InChIKey | SUWFOEMUYHLGEC-NHUHVJRWSA-N |
| XLogP | 2.14 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|