C20H17N3OS — CID 747859
N,3-dimethyl-N,1-diphenylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 747859) has the molecular formula C20H17N3OS and a molecular weight of 347.44 g/mol. Its IUPAC name is N,3-dimethyl-N,1-diphenylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | N,3-dimethyl-N,1-diphenylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 747859 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N,3-dimethyl-N,1-diphenylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2sc(C(=O)N(C)c3ccccc3)cc12 |
| InChI | InChI=1S/C20H17N3OS/c1-14-17-13-18(19(24)22(2)15-9-5-3-6-10-15)25-20(17)23(21-14)16-11-7-4-8-12-16/h3-13H,1-2H3 |
| InChIKey | XOZACOLLZVWJHN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |