C9H9BF3N2- — CID 74787622
(2,5-dimethylindazol-4-yl)-trifluoroboranuide (PubChem CID 74787622) has the molecular formula C9H9BF3N2- and a molecular weight of 212.99 g/mol. Its IUPAC name is (2,5-dimethylindazol-4-yl)-trifluoroboranuide.
| Compound Name | (2,5-dimethylindazol-4-yl)-trifluoroboranuide |
|---|---|
| PubChem CID | 74787622 |
| Molecular Formula | C9H9BF3N2- |
| Molecular Weight | 212.99 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (2,5-dimethylindazol-4-yl)-trifluoroboranuide |
| SMILES | Cc1ccc2nn(C)cc2c1[B-](F)(F)F |
| InChI | InChI=1S/C9H9BF3N2/c1-6-3-4-8-7(5-15(2)14-8)9(6)10(11,12)13/h3-5H,1-2H3/q-1 |
| InChIKey | NYJWTQCXMOHVAH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.99 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|