About 7-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine
7-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine (PubChem CID 74788146) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 7-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine.
Analyze 7-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine?
The IUPAC name of 7-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine (CID 74788146) is 7-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine.
What is the SMILES notation for 7-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine?
The canonical SMILES for 7-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine is C=Cc1cnc2c(c1)OCCO2.
What is the InChIKey of 7-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine?
The InChIKey is DYMKHDROQWGXPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c1-2-7-5-8-9(10-6-7)12-4-3-11-8/h2,5-6H,1,3-4H2.
What are the key properties of 7-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine?
7-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine has a molecular weight of 163.18 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethenyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine is sourced from PubChem (CID 74788146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).