C16H23BN2O3 — CID 74788292
N-[6-methyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-pyridinyl]acetamide (PubChem CID 74788292) has the molecular formula C16H23BN2O3 and a molecular weight of 302.18 g/mol. Its IUPAC name is N-[6-methyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-pyridinyl]acetamide.
| Compound Name | N-[6-methyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 74788292 |
| Molecular Formula | C16H23BN2O3 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | N-[6-methyl-5-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C/B2OC(C)(C)C(C)(C)O2)c(C)n1 |
| InChI | InChI=1S/C16H23BN2O3/c1-11-13(7-8-14(18-11)19-12(2)20)9-10-17-21-15(3,4)16(5,6)22-17/h7-10H,1-6H3,(H,18,19,20)/b10-9+ |
| InChIKey | WAIPSBXKFOHMNM-MDZDMXLPSA-N |
| XLogP | 2.99 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|