C16H24BBrN2O4 — CID 74788472
tert-butyl N-[3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate (PubChem CID 74788472) has the molecular formula C16H24BBrN2O4 and a molecular weight of 399.09 g/mol. Its IUPAC name is tert-butyl N-[3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 74788472 |
| Molecular Formula | C16H24BBrN2O4 |
| Molecular Weight | 399.09 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | tert-butyl N-[3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ncc(B2OC(C)(C)C(C)(C)O2)cc1Br |
| InChI | InChI=1S/C16H24BBrN2O4/c1-14(2,3)22-13(21)20-12-11(18)8-10(9-19-12)17-23-15(4,5)16(6,7)24-17/h8-9H,1-7H3,(H,19,20,21) |
| InChIKey | HLOADOOWPUHVNI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.09 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|