C13H17BClNO3 — CID 74788982
2-chloro-4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-ol (PubChem CID 74788982) has the molecular formula C13H17BClNO3 and a molecular weight of 281.55 g/mol. Its IUPAC name is 2-chloro-4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-ol.
| Compound Name | 2-chloro-4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-ol |
|---|---|
| PubChem CID | 74788982 |
| Molecular Formula | C13H17BClNO3 |
| Molecular Weight | 281.55 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-chloro-4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridin-3-ol |
| SMILES | CC1(C)OB(/C=C/c2ccnc(Cl)c2O)OC1(C)C |
| InChI | InChI=1S/C13H17BClNO3/c1-12(2)13(3,4)19-14(18-12)7-5-9-6-8-16-11(15)10(9)17/h5-8,17H,1-4H3/b7-5+ |
| InChIKey | RMJIPKHVXDWGLA-FNORWQNLSA-N |
| XLogP | 3.09 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|