C16H19BN2O2 — CID 74788995
4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,8-naphthyridine (PubChem CID 74788995) has the molecular formula C16H19BN2O2 and a molecular weight of 282.15 g/mol. Its IUPAC name is 4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,8-naphthyridine.
| Compound Name | 4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,8-naphthyridine |
|---|---|
| PubChem CID | 74788995 |
| Molecular Formula | C16H19BN2O2 |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,8-naphthyridine |
| SMILES | CC1(C)OB(/C=C/c2ccnc3ncccc23)OC1(C)C |
| InChI | InChI=1S/C16H19BN2O2/c1-15(2)16(3,4)21-17(20-15)9-7-12-8-11-19-14-13(12)6-5-10-18-14/h5-11H,1-4H3/b9-7+ |
| InChIKey | NLRPYOHNKQVCKB-VQHVLOKHSA-N |
| XLogP | 3.27 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|