C16H23BN2O2 — CID 74789132
2-[(2S)-azetidin-2-yl]-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine (PubChem CID 74789132) has the molecular formula C16H23BN2O2 and a molecular weight of 286.18 g/mol. Its IUPAC name is 2-[(2S)-azetidin-2-yl]-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine.
| Compound Name | 2-[(2S)-azetidin-2-yl]-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine |
|---|---|
| PubChem CID | 74789132 |
| Molecular Formula | C16H23BN2O2 |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-[(2S)-azetidin-2-yl]-6-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]pyridine |
| SMILES | CC1(C)OB(/C=C/c2cccc([C@@H]3CCN3)n2)OC1(C)C |
| InChI | InChI=1S/C16H23BN2O2/c1-15(2)16(3,4)21-17(20-15)10-8-12-6-5-7-14(19-12)13-9-11-18-13/h5-8,10,13,18H,9,11H2,1-4H3/b10-8+/t13-/m0/s1 |
| InChIKey | IMLJXDSNBCVCGR-FROQITRMSA-N |
| XLogP | 2.76 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|