C26H30F2N2O2 — CID 74793489
3-(2,6-difluorophenyl)-N-[[8-[(2-methylphenyl)methyl]-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]prop-2-enamide (PubChem CID 74793489) has the molecular formula C26H30F2N2O2 and a molecular weight of 440.53 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-N-[[8-[(2-methylphenyl)methyl]-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]prop-2-enamide.
| Compound Name | 3-(2,6-difluorophenyl)-N-[[8-[(2-methylphenyl)methyl]-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 74793489 |
| Molecular Formula | C26H30F2N2O2 |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 3-(2,6-difluorophenyl)-N-[[8-[(2-methylphenyl)methyl]-1-oxa-8-azaspiro[4.5]decan-2-yl]methyl]prop-2-enamide |
| SMILES | Cc1ccccc1CN1CCC2(CCC(CNC(=O)C=Cc3c(F)cccc3F)O2)CC1 |
| InChI | InChI=1S/C26H30F2N2O2/c1-19-5-2-3-6-20(19)18-30-15-13-26(14-16-30)12-11-21(32-26)17-29-25(31)10-9-22-23(27)7-4-8-24(22)28/h2-10,21H,11-18H2,1H3,(H,29,31) |
| InChIKey | IQZVIFHHUZAALZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|