C23H30NO+ — CID 7480088
(2R,3R,4S,6R)-3-methyl-2,6-bis(4-methylphenyl)-4-prop-2-enylpiperidin-1-ium-4-ol (PubChem CID 7480088) has the molecular formula C23H30NO+ and a molecular weight of 336.50 g/mol. Its IUPAC name is (2R,3R,4S,6R)-3-methyl-2,6-bis(4-methylphenyl)-4-prop-2-enylpiperidin-1-ium-4-ol.
| Compound Name | (2R,3R,4S,6R)-3-methyl-2,6-bis(4-methylphenyl)-4-prop-2-enylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7480088 |
| Molecular Formula | C23H30NO+ |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (2R,3R,4S,6R)-3-methyl-2,6-bis(4-methylphenyl)-4-prop-2-enylpiperidin-1-ium-4-ol |
| SMILES | C=CC[C@]1(O)C[C@H](c2ccc(C)cc2)[NH2+][C@@H](c2ccc(C)cc2)[C@H]1C |
| InChI | InChI=1S/C23H29NO/c1-5-14-23(25)15-21(19-10-6-16(2)7-11-19)24-22(18(23)4)20-12-8-17(3)9-13-20/h5-13,18,21-22,24-25H,1,14-15H2,2-4H3/p+1/t18-,21-,22-,23+/m1/s1 |
| InChIKey | WVYVXHXBWSTQOR-HWHRFOGPSA-O |
| XLogP | 4.00 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|