C18H24N4O2S — CID 74801902
3-(4-methoxyphenyl)-N-[[4-methyl-5-(2-methylpropylsulfanyl)-1,2,4-triazol-3-yl]methyl]prop-2-enamide (PubChem CID 74801902) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-[[4-methyl-5-(2-methylpropylsulfanyl)-1,2,4-triazol-3-yl]methyl]prop-2-enamide.
| Compound Name | 3-(4-methoxyphenyl)-N-[[4-methyl-5-(2-methylpropylsulfanyl)-1,2,4-triazol-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 74801902 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-[[4-methyl-5-(2-methylpropylsulfanyl)-1,2,4-triazol-3-yl]methyl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NCc2nnc(SCC(C)C)n2C)cc1 |
| InChI | InChI=1S/C18H24N4O2S/c1-13(2)12-25-18-21-20-16(22(18)3)11-19-17(23)10-7-14-5-8-15(24-4)9-6-14/h5-10,13H,11-12H2,1-4H3,(H,19,23) |
| InChIKey | BNJWLBOPKRVWOD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|