C18H20ClN4S+ — CID 7480361
(3-chlorophenyl)methyl-methyl-[[5-(4-methylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]azanium (PubChem CID 7480361) has the molecular formula C18H20ClN4S+ and a molecular weight of 359.91 g/mol. Its IUPAC name is (3-chlorophenyl)methyl-methyl-[[5-(4-methylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]azanium.
| Compound Name | (3-chlorophenyl)methyl-methyl-[[5-(4-methylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 7480361 |
| Molecular Formula | C18H20ClN4S+ |
| Molecular Weight | 359.91 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (3-chlorophenyl)methyl-methyl-[[5-(4-methylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]azanium |
| SMILES | Cc1ccc(-c2nc(=S)n(C[NH+](C)Cc3cccc(Cl)c3)[nH]2)cc1 |
| InChI | InChI=1S/C18H19ClN4S/c1-13-6-8-15(9-7-13)17-20-18(24)23(21-17)12-22(2)11-14-4-3-5-16(19)10-14/h3-10H,11-12H2,1-2H3,(H,20,21,24)/p+1 |
| InChIKey | AQXOARVVHYYWDG-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.91 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|