C16H14N2O2S2 — CID 748055
4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 748055) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 748055 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C16H14N2O2S2/c1-12-7-9-14(10-8-12)22(19,20)18-16-17-15(11-21-16)13-5-3-2-4-6-13/h2-11H,1H3,(H,17,18) |
| InChIKey | MLWXUOVWRAMXFK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|