C18H27N3O4 — CID 74809410
[2-(hydroxymethyl)piperidin-1-yl]-[5-[(2-methoxyphenoxy)methyl]pyrazolidin-3-yl]methanone (PubChem CID 74809410) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is [2-(hydroxymethyl)piperidin-1-yl]-[5-[(2-methoxyphenoxy)methyl]pyrazolidin-3-yl]methanone.
| Compound Name | [2-(hydroxymethyl)piperidin-1-yl]-[5-[(2-methoxyphenoxy)methyl]pyrazolidin-3-yl]methanone |
|---|---|
| PubChem CID | 74809410 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | [2-(hydroxymethyl)piperidin-1-yl]-[5-[(2-methoxyphenoxy)methyl]pyrazolidin-3-yl]methanone |
| SMILES | COc1ccccc1OCC1CC(C(=O)N2CCCCC2CO)NN1 |
| InChI | InChI=1S/C18H27N3O4/c1-24-16-7-2-3-8-17(16)25-12-13-10-15(20-19-13)18(23)21-9-5-4-6-14(21)11-22/h2-3,7-8,13-15,19-20,22H,4-6,9-12H2,1H3 |
| InChIKey | NTZHCPSNDBAMNZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |