About ethyl 2-[4-[[3-(3,4,5-trimethoxyphenyl)pyrazolidin-4-yl]methyl]morpholin-3-yl]acetate
ethyl 2-[4-[[3-(3,4,5-trimethoxyphenyl)pyrazolidin-4-yl]methyl]morpholin-3-yl]acetate (PubChem CID 74809841) has the molecular formula C21H33N3O6
and a molecular weight of 423.51 g/mol. Its IUPAC name is ethyl 2-[4-[[3-(3,4,5-trimethoxyphenyl)pyrazolidin-4-yl]methyl]morpholin-3-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[4-[[3-(3,4,5-trimethoxyphenyl)pyrazolidin-4-yl]methyl]morpholin-3-yl]acetate |
| PubChem CID | 74809841 |
| Molecular Formula | C21H33N3O6 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | ethyl 2-[4-[[3-(3,4,5-trimethoxyphenyl)pyrazolidin-4-yl]methyl]morpholin-3-yl]acetate |
| SMILES | CCOC(=O)CC1COCCN1CC1CNNC1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H33N3O6/c1-5-30-19(25)10-16-13-29-7-6-24(16)12-15-11-22-23-20(15)14-8-17(26-2)21(28-4)18(9-14)27-3/h8-9,15-16,20,22-23H,5-7,10-13H2,1-4H3 |
| InChIKey | SUWRDWDVJTWRDL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze ethyl 2-[4-[[3-(3,4,5-trimethoxyphenyl)pyrazolidin-4-yl]methyl]morpholin-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-[[3-(3,4,5-trimethoxyphenyl)pyrazolidin-4-yl]methyl]morpholin-3-yl]acetate?
The IUPAC name of ethyl 2-[4-[[3-(3,4,5-trimethoxyphenyl)pyrazolidin-4-yl]methyl]morpholin-3-yl]acetate (CID 74809841) is ethyl 2-[4-[[3-(3,4,5-trimethoxyphenyl)pyrazolidin-4-yl]methyl]morpholin-3-yl]acetate.
What is the SMILES notation for ethyl 2-[4-[[3-(3,4,5-trimethoxyphenyl)pyrazolidin-4-yl]methyl]morpholin-3-yl]acetate?
The canonical SMILES for ethyl 2-[4-[[3-(3,4,5-trimethoxyphenyl)pyrazolidin-4-yl]methyl]morpholin-3-yl]acetate is CCOC(=O)CC1COCCN1CC1CNNC1c1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of ethyl 2-[4-[[3-(3,4,5-trimethoxyphenyl)pyrazolidin-4-yl]methyl]morpholin-3-yl]acetate?
The InChIKey is SUWRDWDVJTWRDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33N3O6/c1-5-30-19(25)10-16-13-29-7-6-24(16)12-15-11-22-23-20(15)14-8-17(26-2)21(28-4)18(9-14)27-3/h8-9,15-16,20,22-23H,5-7,10-13H2,1-4H3.
What are the key properties of ethyl 2-[4-[[3-(3,4,5-trimethoxyphenyl)pyrazolidin-4-yl]methyl]morpholin-3-yl]acetate?
ethyl 2-[4-[[3-(3,4,5-trimethoxyphenyl)pyrazolidin-4-yl]methyl]morpholin-3-yl]acetate has a molecular weight of 423.51 g/mol, XLogP of 1.13, 9 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-[[3-(3,4,5-trimethoxyphenyl)pyrazolidin-4-yl]methyl]morpholin-3-yl]acetate is sourced from PubChem (CID 74809841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).