C17H18N4O2S3 — CID 74813181
1-[5,5-dimethyl-2-sulfanylidene-3-(thiophen-2-ylmethylideneamino)-1,3-thiazolidin-4-yl]-1-hydroxy-3-phenylurea (PubChem CID 74813181) has the molecular formula C17H18N4O2S3 and a molecular weight of 406.56 g/mol. Its IUPAC name is 1-[5,5-dimethyl-2-sulfanylidene-3-(thiophen-2-ylmethylideneamino)-1,3-thiazolidin-4-yl]-1-hydroxy-3-phenylurea.
| Compound Name | 1-[5,5-dimethyl-2-sulfanylidene-3-(thiophen-2-ylmethylideneamino)-1,3-thiazolidin-4-yl]-1-hydroxy-3-phenylurea |
|---|---|
| PubChem CID | 74813181 |
| Molecular Formula | C17H18N4O2S3 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 1-[5,5-dimethyl-2-sulfanylidene-3-(thiophen-2-ylmethylideneamino)-1,3-thiazolidin-4-yl]-1-hydroxy-3-phenylurea |
| SMILES | CC1(C)SC(=S)N(N=Cc2cccs2)C1N(O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H18N4O2S3/c1-17(2)14(21(23)15(22)19-12-7-4-3-5-8-12)20(16(24)26-17)18-11-13-9-6-10-25-13/h3-11,14,23H,1-2H3,(H,19,22) |
| InChIKey | NRUCIBZFPFTGGX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|