C19H23NO4S — CID 74816309
ethyl 2-methyl-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate (PubChem CID 74816309) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is ethyl 2-methyl-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | ethyl 2-methyl-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 74816309 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | ethyl 2-methyl-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C(C)C(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H23NO4S/c1-4-24-19(21)15(3)18(16-8-6-5-7-9-16)20-25(22,23)17-12-10-14(2)11-13-17/h5-13,15,18,20H,4H2,1-3H3 |
| InChIKey | IMKPYKYUSSWFAH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |