C19H14F2N4O — CID 7481655
(3S,6S)-4-cyclopropyl-6-[4-(difluoromethoxy)phenyl]-2-iminocyclohex-4-ene-1,1,3-tricarbonitrile (PubChem CID 7481655) has the molecular formula C19H14F2N4O and a molecular weight of 352.34 g/mol. Its IUPAC name is (3S,6S)-4-cyclopropyl-6-[4-(difluoromethoxy)phenyl]-2-iminocyclohex-4-ene-1,1,3-tricarbonitrile.
| Compound Name | (3S,6S)-4-cyclopropyl-6-[4-(difluoromethoxy)phenyl]-2-iminocyclohex-4-ene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 7481655 |
| Molecular Formula | C19H14F2N4O |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (3S,6S)-4-cyclopropyl-6-[4-(difluoromethoxy)phenyl]-2-iminocyclohex-4-ene-1,1,3-tricarbonitrile |
| SMILES | [H]/N=C1\[C@@H](C#N)C(C2CC2)=C[C@@H](c2ccc(OC(F)F)cc2)C1(C#N)C#N |
| InChI | InChI=1S/C19H14F2N4O/c20-18(21)26-13-5-3-12(4-6-13)16-7-14(11-1-2-11)15(8-22)17(25)19(16,9-23)10-24/h3-7,11,15-16,18,25H,1-2H2/b25-17+/t15-,16-/m0/s1 |
| InChIKey | YCFIYRRWHFPYBS-QPBNAJQBSA-N |
| XLogP | 3.91 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|