C18H30O8 — CID 74817087
2-[2-pent-2-enyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclopentyl]acetic acid (PubChem CID 74817087) has the molecular formula C18H30O8 and a molecular weight of 374.43 g/mol. Its IUPAC name is 2-[2-pent-2-enyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclopentyl]acetic acid.
| Compound Name | 2-[2-pent-2-enyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 74817087 |
| Molecular Formula | C18H30O8 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 2-[2-pent-2-enyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclopentyl]acetic acid |
| SMILES | CCC=CCC1C(CC(=O)O)CCC1OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C18H30O8/c1-2-3-4-5-11-10(8-14(20)21)6-7-12(11)25-18-17(24)16(23)15(22)13(9-19)26-18/h3-4,10-13,15-19,22-24H,2,5-9H2,1H3,(H,20,21) |
| InChIKey | GJZJZRWFRZFTEE-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|