C21H28O10 — CID 74817676
11-hydroxy-1,7-dimethyl-11-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3,5-dioxapentacyclo[8.4.0.02,4.04,8.012,14]tetradec-7-en-6-one (PubChem CID 74817676) has the molecular formula C21H28O10 and a molecular weight of 440.45 g/mol. Its IUPAC name is 11-hydroxy-1,7-dimethyl-11-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3,5-dioxapentacyclo[8.4.0.02,4.04,8.012,14]tetradec-7-en-6-one.
| Compound Name | 11-hydroxy-1,7-dimethyl-11-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3,5-dioxapentacyclo[8.4.0.02,4.04,8.012,14]tetradec-7-en-6-one |
|---|---|
| PubChem CID | 74817676 |
| Molecular Formula | C21H28O10 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 11-hydroxy-1,7-dimethyl-11-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3,5-dioxapentacyclo[8.4.0.02,4.04,8.012,14]tetradec-7-en-6-one |
| SMILES | CC1=C2CC3C(O)(COC4OC(CO)C(O)C(O)C4O)C4CC4C3(C)C3OC23OC1=O |
| InChI | InChI=1S/C21H28O10/c1-7-8-4-12-19(2,18-21(8,31-18)30-16(7)26)9-3-10(9)20(12,27)6-28-17-15(25)14(24)13(23)11(5-22)29-17/h9-15,17-18,22-25,27H,3-6H2,1-2H3 |
| InChIKey | TVBSVFGICHJAPP-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 158.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|