C6H14N2O3 — CID 74817913
3,5-diamino-2-methoxyoxan-4-ol (PubChem CID 74817913) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is 3,5-diamino-2-methoxyoxan-4-ol.
| Compound Name | 3,5-diamino-2-methoxyoxan-4-ol |
|---|---|
| PubChem CID | 74817913 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 3,5-diamino-2-methoxyoxan-4-ol |
| SMILES | COC1OCC(N)C(O)C1N |
| InChI | InChI=1S/C6H14N2O3/c1-10-6-4(8)5(9)3(7)2-11-6/h3-6,9H,2,7-8H2,1H3 |
| InChIKey | WPJTUCOSYYNCSR-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |