C41H66O12 — CID 74817972
[12-[3,9-dimethyl-8-(3-methyl-4-oxopentyl)-1,7-dioxaspiro[5.5]undecan-2-yl]-5,9-dihydroxy-4-methoxy-2,8-dimethyl-7-oxotridecan-3-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate (PubChem CID 74817972) has the molecular formula C41H66O12 and a molecular weight of 750.97 g/mol. Its IUPAC name is [12-[3,9-dimethyl-8-(3-methyl-4-oxopentyl)-1,7-dioxaspiro[5.5]undecan-2-yl]-5,9-dihydroxy-4-methoxy-2,8-dimethyl-7-oxotridecan-3-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate.
| Compound Name | [12-[3,9-dimethyl-8-(3-methyl-4-oxopentyl)-1,7-dioxaspiro[5.5]undecan-2-yl]-5,9-dihydroxy-4-methoxy-2,8-dimethyl-7-oxotridecan-3-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate |
|---|---|
| PubChem CID | 74817972 |
| Molecular Formula | C41H66O12 |
| Molecular Weight | 750.97 g/mol |
| Exact Mass | 750.46 |
| IUPAC Name | [12-[3,9-dimethyl-8-(3-methyl-4-oxopentyl)-1,7-dioxaspiro[5.5]undecan-2-yl]-5,9-dihydroxy-4-methoxy-2,8-dimethyl-7-oxotridecan-3-yl] 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate |
| SMILES | COC(C(O)CC(=O)C(C)C(O)CCC(C)C1OC2(CCC(C)C(CCC(C)C(C)=O)O2)CCC1C)C(OC(=O)CCC1=C(C)C(=O)OC1=O)C(C)C |
| InChI | InChI=1S/C41H66O12/c1-22(2)36(50-35(46)16-13-30-27(7)39(47)51-40(30)48)38(49-10)33(45)21-32(44)28(8)31(43)14-11-25(5)37-26(6)18-20-41(53-37)19-17-24(4)34(52-41)15-12-23(3)29(9)42/h22-26,28,31,33-34,36-38,43,45H,11-21H2,1-10H3 |
| InChIKey | AMFQLUYJIGWDCU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.97 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|