About 2,4,6-trimethyloct-6-ene-3,5-diol
2,4,6-trimethyloct-6-ene-3,5-diol (PubChem CID 74818014) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 2,4,6-trimethyloct-6-ene-3,5-diol.
Molecular Properties
| Compound Name | 2,4,6-trimethyloct-6-ene-3,5-diol |
| PubChem CID | 74818014 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 2,4,6-trimethyloct-6-ene-3,5-diol |
| SMILES | CC=C(C)C(O)C(C)C(O)C(C)C |
| InChI | InChI=1S/C11H22O2/c1-6-8(4)11(13)9(5)10(12)7(2)3/h6-7,9-13H,1-5H3 |
| InChIKey | RBOXPRAUSNOGIX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4,6-trimethyloct-6-ene-3,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-trimethyloct-6-ene-3,5-diol?
The IUPAC name of 2,4,6-trimethyloct-6-ene-3,5-diol (CID 74818014) is 2,4,6-trimethyloct-6-ene-3,5-diol.
What is the SMILES notation for 2,4,6-trimethyloct-6-ene-3,5-diol?
The canonical SMILES for 2,4,6-trimethyloct-6-ene-3,5-diol is CC=C(C)C(O)C(C)C(O)C(C)C.
What is the InChIKey of 2,4,6-trimethyloct-6-ene-3,5-diol?
The InChIKey is RBOXPRAUSNOGIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-6-8(4)11(13)9(5)10(12)7(2)3/h6-7,9-13H,1-5H3.
What are the key properties of 2,4,6-trimethyloct-6-ene-3,5-diol?
2,4,6-trimethyloct-6-ene-3,5-diol has a molecular weight of 186.29 g/mol, XLogP of 1.97, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trimethyloct-6-ene-3,5-diol is sourced from PubChem (CID 74818014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).