C11H22N2O7S — CID 74821044
2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethanesulfonic acid (PubChem CID 74821044) has the molecular formula C11H22N2O7S and a molecular weight of 326.37 g/mol. Its IUPAC name is 2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethanesulfonic acid.
| Compound Name | 2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 74821044 |
| Molecular Formula | C11H22N2O7S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethanesulfonic acid |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C11H22N2O7S/c1-11(2,7-14)9(16)10(17)13-4-3-8(15)12-5-6-21(18,19)20/h9,14,16H,3-7H2,1-2H3,(H,12,15)(H,13,17)(H,18,19,20) |
| InChIKey | PSAJPLNSWWYXDV-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|