C28H35N4O4+ — CID 74824636
N-butyl-2-[4-[1-[2-(cyclohexylamino)-2-oxoethyl]-2,4-dioxo-4aH-quinazolin-1-ium-3-yl]phenyl]acetamide (PubChem CID 74824636) has the molecular formula C28H35N4O4+ and a molecular weight of 491.61 g/mol. Its IUPAC name is N-butyl-2-[4-[1-[2-(cyclohexylamino)-2-oxoethyl]-2,4-dioxo-4aH-quinazolin-1-ium-3-yl]phenyl]acetamide.
| Compound Name | N-butyl-2-[4-[1-[2-(cyclohexylamino)-2-oxoethyl]-2,4-dioxo-4aH-quinazolin-1-ium-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 74824636 |
| Molecular Formula | C28H35N4O4+ |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | N-butyl-2-[4-[1-[2-(cyclohexylamino)-2-oxoethyl]-2,4-dioxo-4aH-quinazolin-1-ium-3-yl]phenyl]acetamide |
| SMILES | CCCCNC(=O)Cc1ccc(N2C(=O)C3C=CC=CC3=[N+](CC(=O)NC3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C28H34N4O4/c1-2-3-17-29-25(33)18-20-13-15-22(16-14-20)32-27(35)23-11-7-8-12-24(23)31(28(32)36)19-26(34)30-21-9-5-4-6-10-21/h7-8,11-16,21,23H,2-6,9-10,17-19H2,1H3,(H-,29,30,33,34)/p+1 |
| InChIKey | TWZDGFRODCQGMS-UHFFFAOYSA-O |
| XLogP | 3.26 |
| TPSA | 98.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|