About 6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine
6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine (PubChem CID 748270) has the molecular formula C10H7ClN4
and a molecular weight of 218.65 g/mol. Its IUPAC name is 6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine.
Molecular Properties
| Compound Name | 6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine |
| PubChem CID | 748270 |
| Molecular Formula | C10H7ClN4 |
| Molecular Weight | 218.65 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine |
| SMILES | Cc1nnc2c3ccccc3c(Cl)nn12 |
| InChI | InChI=1S/C10H7ClN4/c1-6-12-13-10-8-5-3-2-4-7(8)9(11)14-15(6)10/h2-5H,1H3 |
| InChIKey | KBOSDDNHLXFFIB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.65 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine?
The IUPAC name of 6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine (CID 748270) is 6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine.
What is the SMILES notation for 6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine?
The canonical SMILES for 6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine is Cc1nnc2c3ccccc3c(Cl)nn12.
What is the InChIKey of 6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine?
The InChIKey is KBOSDDNHLXFFIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClN4/c1-6-12-13-10-8-5-3-2-4-7(8)9(11)14-15(6)10/h2-5H,1H3.
What are the key properties of 6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine?
6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine has a molecular weight of 218.65 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-methyl-[1,2,4]triazolo[3,4-a]phthalazine is sourced from PubChem (CID 748270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).