C24H40OS — CID 74830271
2-icosa-5,8,11,14,17-pentaenylsulfanylbutan-1-ol (PubChem CID 74830271) has the molecular formula C24H40OS and a molecular weight of 376.65 g/mol. Its IUPAC name is 2-icosa-5,8,11,14,17-pentaenylsulfanylbutan-1-ol.
| Compound Name | 2-icosa-5,8,11,14,17-pentaenylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 74830271 |
| Molecular Formula | C24H40OS |
| Molecular Weight | 376.65 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 2-icosa-5,8,11,14,17-pentaenylsulfanylbutan-1-ol |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCSC(CC)CO |
| InChI | InChI=1S/C24H40OS/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-26-24(4-2)23-25/h5-6,8-9,11-12,14-15,17-18,24-25H,3-4,7,10,13,16,19-23H2,1-2H3 |
| InChIKey | KCKIQHADSIAGPJ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.65 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|