C29H26FN7O2 — CID 74834460
4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-5-(4-hydroxyanilino)-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 74834460) has the molecular formula C29H26FN7O2 and a molecular weight of 523.57 g/mol. Its IUPAC name is 4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-5-(4-hydroxyanilino)-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | 4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-5-(4-hydroxyanilino)-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 74834460 |
| Molecular Formula | C29H26FN7O2 |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-5-(4-hydroxyanilino)-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(-c4cccc(F)n4)cc3)c2Nc2ccc(O)cc2)N2C1=NC1CCCC12 |
| InChI | InChI=1S/C29H26FN7O2/c1-35-28(39)25-26(31-19-12-14-20(38)15-13-19)36(34-27(25)37-23-6-2-5-22(23)33-29(35)37)16-17-8-10-18(11-9-17)21-4-3-7-24(30)32-21/h3-4,7-15,22-23,31,38H,2,5-6,16H2,1H3 |
| InChIKey | TUGGRUJWDXJIPM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|