About 2-(2-methoxyanilino)-4,6-dimethylpyridine-3-carboxamide
2-(2-methoxyanilino)-4,6-dimethylpyridine-3-carboxamide (PubChem CID 748345) has the molecular formula C15H17N3O2
and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-4,6-dimethylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-(2-methoxyanilino)-4,6-dimethylpyridine-3-carboxamide |
| PubChem CID | 748345 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2-(2-methoxyanilino)-4,6-dimethylpyridine-3-carboxamide |
| SMILES | COc1ccccc1Nc1nc(C)cc(C)c1C(N)=O |
| InChI | InChI=1S/C15H17N3O2/c1-9-8-10(2)17-15(13(9)14(16)19)18-11-6-4-5-7-12(11)20-3/h4-8H,1-3H3,(H2,16,19)(H,17,18) |
| InChIKey | DDCUUGCWZQRHSB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methoxyanilino)-4,6-dimethylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyanilino)-4,6-dimethylpyridine-3-carboxamide?
The IUPAC name of 2-(2-methoxyanilino)-4,6-dimethylpyridine-3-carboxamide (CID 748345) is 2-(2-methoxyanilino)-4,6-dimethylpyridine-3-carboxamide.
What is the SMILES notation for 2-(2-methoxyanilino)-4,6-dimethylpyridine-3-carboxamide?
The canonical SMILES for 2-(2-methoxyanilino)-4,6-dimethylpyridine-3-carboxamide is COc1ccccc1Nc1nc(C)cc(C)c1C(N)=O.
What is the InChIKey of 2-(2-methoxyanilino)-4,6-dimethylpyridine-3-carboxamide?
The InChIKey is DDCUUGCWZQRHSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2/c1-9-8-10(2)17-15(13(9)14(16)19)18-11-6-4-5-7-12(11)20-3/h4-8H,1-3H3,(H2,16,19)(H,17,18).
What are the key properties of 2-(2-methoxyanilino)-4,6-dimethylpyridine-3-carboxamide?
2-(2-methoxyanilino)-4,6-dimethylpyridine-3-carboxamide has a molecular weight of 271.32 g/mol, XLogP of 2.55, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyanilino)-4,6-dimethylpyridine-3-carboxamide is sourced from PubChem (CID 748345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).