C57H52CuN4O — CID 74836072
copper [5,10,15,20-tetrakis(4-propan-2-ylphenyl)porphyrin-24-id-2-ylidene]methanolate (PubChem CID 74836072) has the molecular formula C57H52CuN4O and a molecular weight of 872.62 g/mol. Its IUPAC name is copper [5,10,15,20-tetrakis(4-propan-2-ylphenyl)porphyrin-24-id-2-ylidene]methanolate.
| Compound Name | copper [5,10,15,20-tetrakis(4-propan-2-ylphenyl)porphyrin-24-id-2-ylidene]methanolate |
|---|---|
| PubChem CID | 74836072 |
| Molecular Formula | C57H52CuN4O |
| Molecular Weight | 872.62 g/mol |
| Exact Mass | 871.34 |
| IUPAC Name | copper [5,10,15,20-tetrakis(4-propan-2-ylphenyl)porphyrin-24-id-2-ylidene]methanolate |
| SMILES | CC(C)c1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(C(C)C)cc3)=C3/C=CC(=N3)/C(c3ccc(C(C)C)cc3)=c3/cc/c([n-]3)=C(\c3ccc(C(C)C)cc3)C3=NC2=CC3=C[O-])cc1.[Cu+2] |
| InChI | InChI=1S/C57H53N4O.Cu/c1-33(2)37-9-17-41(18-10-37)53-46-25-26-47(58-46)54(42-19-11-38(12-20-42)34(3)4)49-29-30-51(60-49)56(44-23-15-40(16-24-44)36(7)8)57-45(32-62)31-52(61-57)55(50-28-27-48(53)59-50)43-21-13-39(14-22-43)35(5)6;/h9-36H,1-8H3,(H-,58,59,60,61,62);/q-1;+2/p-1/b53-46-,53-48-,54-47-,54-49-,55-50-,55-52-,56-51-,57-56-; |
| InChIKey | SIDVBIZUKQRGPO-RBDUSRMESA-M |
| XLogP | 10.97 |
| TPSA | 74.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.62 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|